C30H32Cl2IN3O4S — CID 132647560
2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-cyclopentylbutanamide (PubChem CID 132647560) has the molecular formula C30H32Cl2IN3O4S and a molecular weight of 728.48 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132647560 |
| Molecular Formula | C30H32Cl2IN3O4S |
| Molecular Weight | 728.48 g/mol |
| Exact Mass | 727.05 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H32Cl2IN3O4S/c1-2-28(30(38)34-23-8-6-7-9-23)35(19-21-12-17-26(31)27(32)18-21)29(37)20-36(24-15-13-22(33)14-16-24)41(39,40)25-10-4-3-5-11-25/h3-5,10-18,23,28H,2,6-9,19-20H2,1H3,(H,34,38) |
| InChIKey | HZWGEIMBEODTNV-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|