C23H28Cl2IN3O4S — CID 100592993
(2R)-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-propylbutanamide (PubChem CID 100592993) has the molecular formula C23H28Cl2IN3O4S and a molecular weight of 640.37 g/mol. Its IUPAC name is (2R)-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-propylbutanamide.
| Compound Name | (2R)-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100592993 |
| Molecular Formula | C23H28Cl2IN3O4S |
| Molecular Weight | 640.37 g/mol |
| Exact Mass | 639.02 |
| IUPAC Name | (2R)-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@@H](CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H28Cl2IN3O4S/c1-4-12-27-23(31)21(5-2)28(14-16-6-11-19(24)20(25)13-16)22(30)15-29(34(3,32)33)18-9-7-17(26)8-10-18/h6-11,13,21H,4-5,12,14-15H2,1-3H3,(H,27,31)/t21-/m1/s1 |
| InChIKey | ZHNULYIBOBNDCG-OAQYLSRUSA-N |
| XLogP | 4.70 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|