C31H34Cl2IN3O4S — CID 100652770
(2S)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100652770) has the molecular formula C31H34Cl2IN3O4S and a molecular weight of 742.51 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100652770 |
| Molecular Formula | C31H34Cl2IN3O4S |
| Molecular Weight | 742.51 g/mol |
| Exact Mass | 741.07 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CS(=O)(=O)N(CC(=O)N(Cc1ccc(Cl)c(Cl)c1)[C@@H](Cc1ccccc1)C(=O)NC1CCCCC1)c1ccc(I)cc1 |
| InChI | InChI=1S/C31H34Cl2IN3O4S/c1-42(40,41)37(26-15-13-24(34)14-16-26)21-30(38)36(20-23-12-17-27(32)28(33)18-23)29(19-22-8-4-2-5-9-22)31(39)35-25-10-6-3-7-11-25/h2,4-5,8-9,12-18,25,29H,3,6-7,10-11,19-21H2,1H3,(H,35,39)/t29-/m0/s1 |
| InChIKey | IXGACCKRBPGMFP-LJAQVGFWSA-N |
| XLogP | 6.45 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.51 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|