C26H26Cl2IN3O4S — CID 132645673
2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 132645673) has the molecular formula C26H26Cl2IN3O4S and a molecular weight of 674.39 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132645673 |
| Molecular Formula | C26H26Cl2IN3O4S |
| Molecular Weight | 674.39 g/mol |
| Exact Mass | 673.01 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H26Cl2IN3O4S/c1-30-26(34)24(15-18-6-4-3-5-7-18)31(16-19-8-13-22(27)23(28)14-19)25(33)17-32(37(2,35)36)21-11-9-20(29)10-12-21/h3-14,24H,15-17H2,1-2H3,(H,30,34) |
| InChIKey | NHKOECUSHZNGBP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|