C29H33ClIN3O4S — CID 133262739
N-tert-butyl-2-[(4-chlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 133262739) has the molecular formula C29H33ClIN3O4S and a molecular weight of 682.02 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-chlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-tert-butyl-2-[(4-chlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133262739 |
| Molecular Formula | C29H33ClIN3O4S |
| Molecular Weight | 682.02 g/mol |
| Exact Mass | 681.09 |
| IUPAC Name | N-tert-butyl-2-[(4-chlorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CC(C)(C)NC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C29H33ClIN3O4S/c1-29(2,3)32-28(36)26(18-21-8-6-5-7-9-21)33(19-22-10-12-23(30)13-11-22)27(35)20-34(39(4,37)38)25-16-14-24(31)15-17-25/h5-17,26H,18-20H2,1-4H3,(H,32,36) |
| InChIKey | JRKRNQIWPYQINZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.02 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|