C24H39N2O9P — CID 87516038
acetic acid;ethyl 2-[[2-[benzyl-(2-diethoxyphosphorylacetyl)amino]-3-methylbutanoyl]amino]acetate (PubChem CID 87516038) has the molecular formula C24H39N2O9P and a molecular weight of 530.56 g/mol. Its IUPAC name is acetic acid;ethyl 2-[[2-[benzyl-(2-diethoxyphosphorylacetyl)amino]-3-methylbutanoyl]amino]acetate.
| Compound Name | acetic acid;ethyl 2-[[2-[benzyl-(2-diethoxyphosphorylacetyl)amino]-3-methylbutanoyl]amino]acetate |
|---|---|
| PubChem CID | 87516038 |
| Molecular Formula | C24H39N2O9P |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | acetic acid;ethyl 2-[[2-[benzyl-(2-diethoxyphosphorylacetyl)amino]-3-methylbutanoyl]amino]acetate |
| SMILES | CC(=O)O.CCOC(=O)CNC(=O)C(C(C)C)N(Cc1ccccc1)C(=O)CP(=O)(OCC)OCC |
| InChI | InChI=1S/C22H35N2O7P.C2H4O2/c1-6-29-20(26)14-23-22(27)21(17(4)5)24(15-18-12-10-9-11-13-18)19(25)16-32(28,30-7-2)31-8-3;1-2(3)4/h9-13,17,21H,6-8,14-16H2,1-5H3,(H,23,27);1H3,(H,3,4) |
| InChIKey | XFBPJFADUNIACQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|