C14H23N2O4P — CID 149250728
(2S)-2-amino-N-(diethoxyphosphorylmethyl)-3-phenylpropanamide (PubChem CID 149250728) has the molecular formula C14H23N2O4P and a molecular weight of 314.32 g/mol. Its IUPAC name is (2S)-2-amino-N-(diethoxyphosphorylmethyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-(diethoxyphosphorylmethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 149250728 |
| Molecular Formula | C14H23N2O4P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2S)-2-amino-N-(diethoxyphosphorylmethyl)-3-phenylpropanamide |
| SMILES | CCOP(=O)(CNC(=O)[C@@H](N)Cc1ccccc1)OCC |
| InChI | InChI=1S/C14H23N2O4P/c1-3-19-21(18,20-4-2)11-16-14(17)13(15)10-12-8-6-5-7-9-12/h5-9,13H,3-4,10-11,15H2,1-2H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | YWSLZLAUGSTFIX-ZDUSSCGKSA-N |
| XLogP | 1.90 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|