C30H32N3O7P — CID 23260314
2-[benzyl-[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(diethoxyphosphorylmethyl)-2-phenylacetamide (PubChem CID 23260314) has the molecular formula C30H32N3O7P and a molecular weight of 577.57 g/mol. Its IUPAC name is 2-[benzyl-[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(diethoxyphosphorylmethyl)-2-phenylacetamide.
| Compound Name | 2-[benzyl-[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(diethoxyphosphorylmethyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 23260314 |
| Molecular Formula | C30H32N3O7P |
| Molecular Weight | 577.57 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 2-[benzyl-[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(diethoxyphosphorylmethyl)-2-phenylacetamide |
| SMILES | CCOP(=O)(CNC(=O)C(c1ccccc1)N(Cc1ccccc1)C(=O)CN1C(=O)c2ccccc2C1=O)OCC |
| InChI | InChI=1S/C30H32N3O7P/c1-3-39-41(38,40-4-2)21-31-28(35)27(23-15-9-6-10-16-23)32(19-22-13-7-5-8-14-22)26(34)20-33-29(36)24-17-11-12-18-25(24)30(33)37/h5-18,27H,3-4,19-21H2,1-2H3,(H,31,35) |
| InChIKey | GDSACLUVBFZFEJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|