C17H17F3N2O — CID 24664938
3-benzyl-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 24664938) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is 3-benzyl-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 3-benzyl-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 24664938 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-benzyl-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CN(Cc1ccccc1C(F)(F)F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H17F3N2O/c1-22(16(23)21-11-13-7-3-2-4-8-13)12-14-9-5-6-10-15(14)17(18,19)20/h2-10H,11-12H2,1H3,(H,21,23) |
| InChIKey | KEEIJRMVCOLNJV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |