C18H25F3N2O — CID 55575637
3-(3-cyclopentylpropyl)-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 55575637) has the molecular formula C18H25F3N2O and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-(3-cyclopentylpropyl)-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 3-(3-cyclopentylpropyl)-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55575637 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-(3-cyclopentylpropyl)-1-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CN(Cc1ccccc1C(F)(F)F)C(=O)NCCCC1CCCC1 |
| InChI | InChI=1S/C18H25F3N2O/c1-23(13-15-10-4-5-11-16(15)18(19,20)21)17(24)22-12-6-9-14-7-2-3-8-14/h4-5,10-11,14H,2-3,6-9,12-13H2,1H3,(H,22,24) |
| InChIKey | PZEYLNXTCFQLKA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|