C19H25F3N2O2 — CID 18274940
3-cyclohexyl-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide (PubChem CID 18274940) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-cyclohexyl-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide.
| Compound Name | 3-cyclohexyl-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide |
|---|---|
| PubChem CID | 18274940 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-cyclohexyl-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide |
| SMILES | CN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C19H25F3N2O2/c1-24(18(26)12-11-14-7-3-2-4-8-14)13-17(25)23-16-10-6-5-9-15(16)19(20,21)22/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3,(H,23,25) |
| InChIKey | XQBKKTDVMXAFCC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |