C17H22F3N3O2 — CID 27100580
N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-2-piperidin-1-ylacetamide (PubChem CID 27100580) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-2-piperidin-1-ylacetamide.
| Compound Name | N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 27100580 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-2-piperidin-1-ylacetamide |
| SMILES | CN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)CN1CCCCC1 |
| InChI | InChI=1S/C17H22F3N3O2/c1-22(16(25)12-23-9-5-2-6-10-23)11-15(24)21-14-8-4-3-7-13(14)17(18,19)20/h3-4,7-8H,2,5-6,9-12H2,1H3,(H,21,24) |
| InChIKey | LADBJFUNYQXWPD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |