C16H19F3N2O2 — CID 8503372
N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]cyclopentanecarboxamide (PubChem CID 8503372) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]cyclopentanecarboxamide.
| Compound Name | N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 8503372 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]cyclopentanecarboxamide |
| SMILES | CN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)C1CCCC1 |
| InChI | InChI=1S/C16H19F3N2O2/c1-21(15(23)11-6-2-3-7-11)10-14(22)20-13-9-5-4-8-12(13)16(17,18)19/h4-5,8-9,11H,2-3,6-7,10H2,1H3,(H,20,22) |
| InChIKey | HBFHMULTDCGGRA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |