C15H17F3N2O2 — CID 2534365
N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]cyclopentanecarboxamide (PubChem CID 2534365) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]cyclopentanecarboxamide.
| Compound Name | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 2534365 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]cyclopentanecarboxamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)C1CCCC1 |
| InChI | InChI=1S/C15H17F3N2O2/c1-20(15(22)9-4-2-3-5-9)8-12(21)19-11-7-6-10(16)13(17)14(11)18/h6-7,9H,2-5,8H2,1H3,(H,19,21) |
| InChIKey | PWSUHRSMRCABSF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|