C19H22F6N2O2 — CID 51958265
cis-(1R,3S)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 51958265) has the molecular formula C19H22F6N2O2 and a molecular weight of 424.39 g/mol. Its IUPAC name is cis-(1R,3S)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 51958265 |
| Molecular Formula | C19H22F6N2O2 |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | cis-(1R,3S)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)[C@@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C19H22F6N2O2/c1-2-8-27(18(29)11-4-3-5-12(9-11)19(23,24)25)10-15(28)26-14-7-6-13(20)16(21)17(14)22/h6-7,11-12H,2-5,8-10H2,1H3,(H,26,28)/t11-,12+/m1/s1 |
| InChIKey | XQGKFBNCMORABU-NEPJUHHUSA-N |
| XLogP | 4.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|