C18H24F3N3O4S — CID 55556172
1-methylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpiperidine-3-carboxamide (PubChem CID 55556172) has the molecular formula C18H24F3N3O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpiperidine-3-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55556172 |
| Molecular Formula | C18H24F3N3O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1-methylsulfonyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpiperidine-3-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)C1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C18H24F3N3O4S/c1-3-8-23(18(26)12-5-4-9-24(10-12)29(2,27)28)11-15(25)22-14-7-6-13(19)16(20)17(14)21/h6-7,12H,3-5,8-11H2,1-2H3,(H,22,25) |
| InChIKey | BZBSZQSONROGEZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|