C17H22Cl2N2O2 — CID 42977412
N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propylcyclopentanecarboxamide (PubChem CID 42977412) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propylcyclopentanecarboxamide.
| Compound Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propylcyclopentanecarboxamide |
|---|---|
| PubChem CID | 42977412 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propylcyclopentanecarboxamide |
| SMILES | CCCN(CC(=O)Nc1cc(Cl)ccc1Cl)C(=O)C1CCCC1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-2-9-21(17(23)12-5-3-4-6-12)11-16(22)20-15-10-13(18)7-8-14(15)19/h7-8,10,12H,2-6,9,11H2,1H3,(H,20,22) |
| InChIKey | UNEOPXSFKAMRES-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |