C16H22Cl2N2O4 — CID 78797414
N-(2,5-dichlorophenyl)-2-[[2-(2-methoxyethoxy)acetyl]-propylamino]acetamide (PubChem CID 78797414) has the molecular formula C16H22Cl2N2O4 and a molecular weight of 377.27 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[[2-(2-methoxyethoxy)acetyl]-propylamino]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[[2-(2-methoxyethoxy)acetyl]-propylamino]acetamide |
|---|---|
| PubChem CID | 78797414 |
| Molecular Formula | C16H22Cl2N2O4 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[[2-(2-methoxyethoxy)acetyl]-propylamino]acetamide |
| SMILES | CCCN(CC(=O)Nc1cc(Cl)ccc1Cl)C(=O)COCCOC |
| InChI | InChI=1S/C16H22Cl2N2O4/c1-3-6-20(16(22)11-24-8-7-23-2)10-15(21)19-14-9-12(17)4-5-13(14)18/h4-5,9H,3,6-8,10-11H2,1-2H3,(H,19,21) |
| InChIKey | DMLCRIIRMQEAPQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|