C17H24Cl2N2O2 — CID 55328661
N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propylhexanamide (PubChem CID 55328661) has the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propylhexanamide.
| Compound Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propylhexanamide |
|---|---|
| PubChem CID | 55328661 |
| Molecular Formula | C17H24Cl2N2O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propylhexanamide |
| SMILES | CCCCCC(=O)N(CCC)CC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H24Cl2N2O2/c1-3-5-6-7-17(23)21(10-4-2)12-16(22)20-15-11-13(18)8-9-14(15)19/h8-9,11H,3-7,10,12H2,1-2H3,(H,20,22) |
| InChIKey | IZMBWNOZNDOPDT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|