C18H25ClF3N3O2 — CID 119682416
3-amino-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylcyclohexane-1-carboxamide;hydrochloride (PubChem CID 119682416) has the molecular formula C18H25ClF3N3O2 and a molecular weight of 407.86 g/mol. Its IUPAC name is 3-amino-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylcyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylcyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119682416 |
| Molecular Formula | C18H25ClF3N3O2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 3-amino-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylcyclohexane-1-carboxamide;hydrochloride |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)C1CCCC(N)C1.Cl |
| InChI | InChI=1S/C18H24F3N3O2.ClH/c1-2-8-24(18(26)11-4-3-5-12(22)9-11)10-15(25)23-14-7-6-13(19)16(20)17(14)21;/h6-7,11-12H,2-5,8-10,22H2,1H3,(H,23,25);1H |
| InChIKey | JPMDHBLIZCQULN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|