C18H16F3IN2O2 — CID 27773080
4-iodo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide (PubChem CID 27773080) has the molecular formula C18H16F3IN2O2 and a molecular weight of 476.24 g/mol. Its IUPAC name is 4-iodo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide.
| Compound Name | 4-iodo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 27773080 |
| Molecular Formula | C18H16F3IN2O2 |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | 4-iodo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H16F3IN2O2/c1-2-9-24(18(26)11-3-5-12(22)6-4-11)10-15(25)23-14-8-7-13(19)16(20)17(14)21/h3-8H,2,9-10H2,1H3,(H,23,25) |
| InChIKey | DFBCISCSKRMROS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|