C18H16F3N3O4 — CID 51143517
2-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide (PubChem CID 51143517) has the molecular formula C18H16F3N3O4 and a molecular weight of 395.34 g/mol. Its IUPAC name is 2-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide.
| Compound Name | 2-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 51143517 |
| Molecular Formula | C18H16F3N3O4 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16F3N3O4/c1-2-9-23(18(26)11-5-3-4-6-14(11)24(27)28)10-15(25)22-13-8-7-12(19)16(20)17(13)21/h3-8H,2,9-10H2,1H3,(H,22,25) |
| InChIKey | BHNXBNPTBWLFLF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|