C23H22F3N3O2S2 — CID 55504204
2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide (PubChem CID 55504204) has the molecular formula C23H22F3N3O2S2 and a molecular weight of 493.58 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide.
| Compound Name | 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 55504204 |
| Molecular Formula | C23H22F3N3O2S2 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylbenzamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccccc1SCc1csc(C)n1 |
| InChI | InChI=1S/C23H22F3N3O2S2/c1-3-10-29(11-20(30)28-18-9-8-17(24)21(25)22(18)26)23(31)16-6-4-5-7-19(16)33-13-15-12-32-14(2)27-15/h4-9,12H,3,10-11,13H2,1-2H3,(H,28,30) |
| InChIKey | MEOGRWQBFPQHTD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|