C14H16N2OS2 — CID 47140365
N-ethyl-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide (PubChem CID 47140365) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is N-ethyl-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide.
| Compound Name | N-ethyl-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 47140365 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-ethyl-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzamide |
| SMILES | CCNC(=O)c1ccccc1SCc1csc(C)n1 |
| InChI | InChI=1S/C14H16N2OS2/c1-3-15-14(17)12-6-4-5-7-13(12)19-9-11-8-18-10(2)16-11/h4-8H,3,9H2,1-2H3,(H,15,17) |
| InChIKey | XPCAMLACVNFQQT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |