C17H20N2O3S2 — CID 119234181
5-[[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]amino]pentanoic acid (PubChem CID 119234181) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 5-[[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]amino]pentanoic acid.
| Compound Name | 5-[[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234181 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 5-[[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]amino]pentanoic acid |
| SMILES | Cc1nc(CSc2ccccc2C(=O)NCCCCC(=O)O)cs1 |
| InChI | InChI=1S/C17H20N2O3S2/c1-12-19-13(10-23-12)11-24-15-7-3-2-6-14(15)17(22)18-9-5-4-8-16(20)21/h2-3,6-7,10H,4-5,8-9,11H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | KTOTWHQYBXFSEY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|