C19H16F3N3O2S2 — CID 27773173
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 27773173) has the molecular formula C19H16F3N3O2S2 and a molecular weight of 439.48 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 27773173 |
| Molecular Formula | C19H16F3N3O2S2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C19H16F3N3O2S2/c1-2-7-25(9-15(26)23-12-6-5-11(20)16(21)17(12)22)19(27)13-10-29-18(24-13)14-4-3-8-28-14/h3-6,8,10H,2,7,9H2,1H3,(H,23,26) |
| InChIKey | QHRCOZLRUQAEMG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|