C20H18F3N3O3S — CID 46554976
2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylacetamide (PubChem CID 46554976) has the molecular formula C20H18F3N3O3S and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylacetamide.
| Compound Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylacetamide |
|---|---|
| PubChem CID | 46554976 |
| Molecular Formula | C20H18F3N3O3S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylacetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)Cc1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C20H18F3N3O3S/c1-2-7-26(10-16(27)25-14-6-5-13(21)18(22)19(14)23)17(28)9-12-11-30-20(24-12)15-4-3-8-29-15/h3-6,8,11H,2,7,9-10H2,1H3,(H,25,27) |
| InChIKey | YJSODKSTETUXSJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|