C17H14F3N3O3 — CID 8551086
2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 8551086) has the molecular formula C17H14F3N3O3 and a molecular weight of 365.31 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 8551086 |
| Molecular Formula | C17H14F3N3O3 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)Cc1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C17H14F3N3O3/c1-23(8-10-7-14(26-22-10)13-3-2-6-25-13)9-15(24)21-12-5-4-11(18)16(19)17(12)20/h2-7H,8-9H2,1H3,(H,21,24) |
| InChIKey | JGDJIKMVRHRWIM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|