C17H14N2O5 — CID 30850547
methyl 2-[[2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetyl]amino]benzoate (PubChem CID 30850547) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is methyl 2-[[2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30850547 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | methyl 2-[[2-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)Cc1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C17H14N2O5/c1-22-17(21)12-5-2-3-6-13(12)18-16(20)10-11-9-15(24-19-11)14-7-4-8-23-14/h2-9H,10H2,1H3,(H,18,20) |
| InChIKey | CBWQPKNOXPRWMW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |