C19H17N3O4 — CID 16879078
2-[[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetyl]amino]benzamide (PubChem CID 16879078) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 16879078 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetyl]amino]benzamide |
| SMILES | COc1cccc(-c2cc(CC(=O)Nc3ccccc3C(N)=O)no2)c1 |
| InChI | InChI=1S/C19H17N3O4/c1-25-14-6-4-5-12(9-14)17-10-13(22-26-17)11-18(23)21-16-8-3-2-7-15(16)19(20)24/h2-10H,11H2,1H3,(H2,20,24)(H,21,23) |
| InChIKey | ZWBXOVIRQJSNPN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |