C19H17NO4 — CID 16869792
[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl 2-methylbenzoate (PubChem CID 16869792) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is [5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl 2-methylbenzoate.
| Compound Name | [5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl 2-methylbenzoate |
|---|---|
| PubChem CID | 16869792 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl 2-methylbenzoate |
| SMILES | COc1cccc(-c2cc(COC(=O)c3ccccc3C)no2)c1 |
| InChI | InChI=1S/C19H17NO4/c1-13-6-3-4-9-17(13)19(21)23-12-15-11-18(24-20-15)14-7-5-8-16(10-14)22-2/h3-11H,12H2,1-2H3 |
| InChIKey | PEOPVDFZHGLLLW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |