C18H14ClNO3 — CID 16869440
[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 2-chlorobenzoate (PubChem CID 16869440) has the molecular formula C18H14ClNO3 and a molecular weight of 327.77 g/mol. Its IUPAC name is [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 2-chlorobenzoate.
| Compound Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 2-chlorobenzoate |
|---|---|
| PubChem CID | 16869440 |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 2-chlorobenzoate |
| SMILES | Cc1ccc(-c2cc(COC(=O)c3ccccc3Cl)no2)cc1 |
| InChI | InChI=1S/C18H14ClNO3/c1-12-6-8-13(9-7-12)17-10-14(20-23-17)11-22-18(21)15-4-2-3-5-16(15)19/h2-10H,11H2,1H3 |
| InChIKey | IMVUWLCXOQQXSJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |