C18H13F2NO3 — CID 16869448
[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 3,4-difluorobenzoate (PubChem CID 16869448) has the molecular formula C18H13F2NO3 and a molecular weight of 329.30 g/mol. Its IUPAC name is [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 3,4-difluorobenzoate.
| Compound Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 16869448 |
| Molecular Formula | C18H13F2NO3 |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl 3,4-difluorobenzoate |
| SMILES | Cc1ccc(-c2cc(COC(=O)c3ccc(F)c(F)c3)no2)cc1 |
| InChI | InChI=1S/C18H13F2NO3/c1-11-2-4-12(5-3-11)17-9-14(21-24-17)10-23-18(22)13-6-7-15(19)16(20)8-13/h2-9H,10H2,1H3 |
| InChIKey | QCZMZPHKLLTACK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |