C18H13F2NO4 — CID 16869952
[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3,4-difluorobenzoate (PubChem CID 16869952) has the molecular formula C18H13F2NO4 and a molecular weight of 345.30 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3,4-difluorobenzoate.
| Compound Name | [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 16869952 |
| Molecular Formula | C18H13F2NO4 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methyl 3,4-difluorobenzoate |
| SMILES | COc1ccc(-c2cc(COC(=O)c3ccc(F)c(F)c3)no2)cc1 |
| InChI | InChI=1S/C18H13F2NO4/c1-23-14-5-2-11(3-6-14)17-9-13(21-25-17)10-24-18(22)12-4-7-15(19)16(20)8-12/h2-9H,10H2,1H3 |
| InChIKey | DVXFGXAFUWUUGZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |