C17H11Cl2NO3 — CID 16869565
[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 3-chlorobenzoate (PubChem CID 16869565) has the molecular formula C17H11Cl2NO3 and a molecular weight of 348.19 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 3-chlorobenzoate.
| Compound Name | [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 3-chlorobenzoate |
|---|---|
| PubChem CID | 16869565 |
| Molecular Formula | C17H11Cl2NO3 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl 3-chlorobenzoate |
| SMILES | O=C(OCc1cc(-c2ccc(Cl)cc2)on1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2NO3/c18-13-6-4-11(5-7-13)16-9-15(20-23-16)10-22-17(21)12-2-1-3-14(19)8-12/h1-9H,10H2 |
| InChIKey | XQENJQDUUNGHGY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |