C18H14ClNO2S — CID 7860043
[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 3-chlorobenzoate (PubChem CID 7860043) has the molecular formula C18H14ClNO2S and a molecular weight of 343.84 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 3-chlorobenzoate.
| Compound Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 3-chlorobenzoate |
|---|---|
| PubChem CID | 7860043 |
| Molecular Formula | C18H14ClNO2S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 3-chlorobenzoate |
| SMILES | Cc1ccc(-c2nc(COC(=O)c3cccc(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C18H14ClNO2S/c1-12-5-7-13(8-6-12)17-20-16(11-23-17)10-22-18(21)14-3-2-4-15(19)9-14/h2-9,11H,10H2,1H3 |
| InChIKey | SSLURVGSQRMIRD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |