C18H14BrNO2S — CID 7866284
[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-bromobenzoate (PubChem CID 7866284) has the molecular formula C18H14BrNO2S and a molecular weight of 388.29 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-bromobenzoate.
| Compound Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-bromobenzoate |
|---|---|
| PubChem CID | 7866284 |
| Molecular Formula | C18H14BrNO2S |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-bromobenzoate |
| SMILES | Cc1ccc(-c2nc(COC(=O)c3ccccc3Br)cs2)cc1 |
| InChI | InChI=1S/C18H14BrNO2S/c1-12-6-8-13(9-7-12)17-20-14(11-23-17)10-22-18(21)15-4-2-3-5-16(15)19/h2-9,11H,10H2,1H3 |
| InChIKey | PYBWPXGYNSMEEW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |