C19H16N2O5S — CID 7795094
[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-methyl-3-nitrobenzoate (PubChem CID 7795094) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-methyl-3-nitrobenzoate.
| Compound Name | [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7795094 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-methyl-3-nitrobenzoate |
| SMILES | COc1ccc(-c2nc(COC(=O)c3cccc([N+](=O)[O-])c3C)cs2)cc1 |
| InChI | InChI=1S/C19H16N2O5S/c1-12-16(4-3-5-17(12)21(23)24)19(22)26-10-14-11-27-18(20-14)13-6-8-15(25-2)9-7-13/h3-9,11H,10H2,1-2H3 |
| InChIKey | XTSMVKSCAUBBPX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|