C21H20N2O6S — CID 43035896
[2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate (PubChem CID 43035896) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is [2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate.
| Compound Name | [2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate |
|---|---|
| PubChem CID | 43035896 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-methyl-6-nitrobenzoate |
| SMILES | CCOc1ccc(-c2nc(COC(=O)c3c(C)cccc3[N+](=O)[O-])cs2)cc1OC |
| InChI | InChI=1S/C21H20N2O6S/c1-4-28-17-9-8-14(10-18(17)27-3)20-22-15(12-30-20)11-29-21(24)19-13(2)6-5-7-16(19)23(25)26/h5-10,12H,4,11H2,1-3H3 |
| InChIKey | PZUFBEBFSYDAPS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|