C23H20N2O6S — CID 30043651
[2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 30043651) has the molecular formula C23H20N2O6S and a molecular weight of 452.49 g/mol. Its IUPAC name is [2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 30043651 |
| Molecular Formula | C23H20N2O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [2-(4-ethoxy-3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | CCOc1ccc(-c2nc(COC(=O)CN3C(=O)c4ccccc4C3=O)cs2)cc1OC |
| InChI | InChI=1S/C23H20N2O6S/c1-3-30-18-9-8-14(10-19(18)29-2)21-24-15(13-32-21)12-31-20(26)11-25-22(27)16-6-4-5-7-17(16)23(25)28/h4-10,13H,3,11-12H2,1-2H3 |
| InChIKey | ADKHDRVHAMJVMC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|