C22H18N2O4S — CID 40746831
[2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 40746831) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 40746831 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | CCc1ccc(-c2nc(COC(=O)CN3C(=O)c4ccccc4C3=O)cs2)cc1 |
| InChI | InChI=1S/C22H18N2O4S/c1-2-14-7-9-15(10-8-14)20-23-16(13-29-20)12-28-19(25)11-24-21(26)17-5-3-4-6-18(17)22(24)27/h3-10,13H,2,11-12H2,1H3 |
| InChIKey | VAAYXKBKJKDIJR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|