C17H16N2O5S — CID 55322934
[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(2,5-dioxopyrrolidin-1-yl)acetate (PubChem CID 55322934) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(2,5-dioxopyrrolidin-1-yl)acetate.
| Compound Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(2,5-dioxopyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55322934 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(2,5-dioxopyrrolidin-1-yl)acetate |
| SMILES | COc1cccc(-c2nc(COC(=O)CN3C(=O)CCC3=O)cs2)c1 |
| InChI | InChI=1S/C17H16N2O5S/c1-23-13-4-2-3-11(7-13)17-18-12(10-25-17)9-24-16(22)8-19-14(20)5-6-15(19)21/h2-4,7,10H,5-6,8-9H2,1H3 |
| InChIKey | JHARCXISUGZYAV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|