C19H17N3O4S — CID 8804178
[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(carbamoylamino)benzoate (PubChem CID 8804178) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(carbamoylamino)benzoate.
| Compound Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 8804178 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3-(carbamoylamino)benzoate |
| SMILES | COc1cccc(-c2nc(COC(=O)c3cccc(NC(N)=O)c3)cs2)c1 |
| InChI | InChI=1S/C19H17N3O4S/c1-25-16-7-3-4-12(9-16)17-21-15(11-27-17)10-26-18(23)13-5-2-6-14(8-13)22-19(20)24/h2-9,11H,10H2,1H3,(H3,20,22,24) |
| InChIKey | ZLCSPAJHISJLRO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |