C18H14FNO3S — CID 7789627
[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate (PubChem CID 7789627) has the molecular formula C18H14FNO3S and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate.
| Compound Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 7789627 |
| Molecular Formula | C18H14FNO3S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate |
| SMILES | COc1cccc(-c2nc(COC(=O)c3ccc(F)cc3)cs2)c1 |
| InChI | InChI=1S/C18H14FNO3S/c1-22-16-4-2-3-13(9-16)17-20-15(11-24-17)10-23-18(21)12-5-7-14(19)8-6-12/h2-9,11H,10H2,1H3 |
| InChIKey | OVYDDTNNMOLZCX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |