C25H31N3O4S — CID 47094202
[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 47094202) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 47094202 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | Cc1ccc(-c2nc(COC(=O)CN3C(=O)NC4(CCC(C(C)(C)C)CC4)C3=O)cs2)cc1 |
| InChI | InChI=1S/C25H31N3O4S/c1-16-5-7-17(8-6-16)21-26-19(15-33-21)14-32-20(29)13-28-22(30)25(27-23(28)31)11-9-18(10-12-25)24(2,3)4/h5-8,15,18H,9-14H2,1-4H3,(H,27,31) |
| InChIKey | RTCRYZINNMBWEH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|