C25H31N3O6 — CID 24657434
[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 24657434) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 24657434 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | COc1ccc(-c2nc(COC(=O)CN3C(=O)NC4(CCC(C(C)(C)C)CC4)C3=O)co2)cc1 |
| InChI | InChI=1S/C25H31N3O6/c1-24(2,3)17-9-11-25(12-10-17)22(30)28(23(31)27-25)13-20(29)33-14-18-15-34-21(26-18)16-5-7-19(32-4)8-6-16/h5-8,15,17H,9-14H2,1-4H3,(H,27,31) |
| InChIKey | CRFNQUBLWZEGAY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|