C15H17NO4 — CID 55537653
[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl butanoate (PubChem CID 55537653) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl butanoate.
| Compound Name | [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl butanoate |
|---|---|
| PubChem CID | 55537653 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl butanoate |
| SMILES | CCCC(=O)OCc1coc(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C15H17NO4/c1-3-4-14(17)19-9-12-10-20-15(16-12)11-5-7-13(18-2)8-6-11/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | DHEMNLCRXZLXHW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |