C19H20FN3O3 — CID 31688665
3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 31688665) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is 3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 31688665 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(Cc1coc(-c3ccc(F)cc3)n1)C2=O |
| InChI | InChI=1S/C19H20FN3O3/c1-12-6-8-19(9-7-12)17(24)23(18(25)22-19)10-15-11-26-16(21-15)13-2-4-14(20)5-3-13/h2-5,11-12H,6-10H2,1H3,(H,22,25) |
| InChIKey | JMKCBCYQPNWSTO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|