C20H27FN3O2+ — CID 9285702
cyclopropyl-[(4-fluorophenyl)methyl]-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]azanium (PubChem CID 9285702) has the molecular formula C20H27FN3O2+ and a molecular weight of 360.45 g/mol. Its IUPAC name is cyclopropyl-[(4-fluorophenyl)methyl]-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]azanium.
| Compound Name | cyclopropyl-[(4-fluorophenyl)methyl]-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 9285702 |
| Molecular Formula | C20H27FN3O2+ |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | cyclopropyl-[(4-fluorophenyl)methyl]-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]azanium |
| SMILES | CC1CCC2(CC1)NC(=O)N(C[NH+](Cc1ccc(F)cc1)C1CC1)C2=O |
| InChI | InChI=1S/C20H26FN3O2/c1-14-8-10-20(11-9-14)18(25)24(19(26)22-20)13-23(17-6-7-17)12-15-2-4-16(21)5-3-15/h2-5,14,17H,6-13H2,1H3,(H,22,26)/p+1 |
| InChIKey | IPMQFVPBYYLOJJ-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|