C19H25FN3O2+ — CID 9285758
cyclopropyl-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-[(4-fluorophenyl)methyl]azanium (PubChem CID 9285758) has the molecular formula C19H25FN3O2+ and a molecular weight of 346.43 g/mol. Its IUPAC name is cyclopropyl-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-[(4-fluorophenyl)methyl]azanium.
| Compound Name | cyclopropyl-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 9285758 |
| Molecular Formula | C19H25FN3O2+ |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | cyclopropyl-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-[(4-fluorophenyl)methyl]azanium |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1C[NH+](Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C19H24FN3O2/c20-15-6-4-14(5-7-15)12-22(16-8-9-16)13-23-17(24)19(21-18(23)25)10-2-1-3-11-19/h4-7,16H,1-3,8-13H2,(H,21,25)/p+1 |
| InChIKey | ZLZMKXZCLWDEMZ-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|